C16H24N2S — CID 134417320
(1E,3E)-N,N,2-trimethyl-4-(2-methyl-2,3-dihydrothiophen-5-yl)-5-prop-2-enyliminopenta-1,3-dien-1-amine (PubChem CID 134417320) has the molecular formula C16H24N2S and a molecular weight of 276.45 g/mol. Its IUPAC name is (1E,3E)-N,N,2-trimethyl-4-(2-methyl-2,3-dihydrothiophen-5-yl)-5-prop-2-enyliminopenta-1,3-dien-1-amine.
| Compound Name | (1E,3E)-N,N,2-trimethyl-4-(2-methyl-2,3-dihydrothiophen-5-yl)-5-prop-2-enyliminopenta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 134417320 |
| Molecular Formula | C16H24N2S |
| Molecular Weight | 276.45 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | (1E,3E)-N,N,2-trimethyl-4-(2-methyl-2,3-dihydrothiophen-5-yl)-5-prop-2-enyliminopenta-1,3-dien-1-amine |
| SMILES | C=CC/N=C/C(=C\C(C)=C\N(C)C)C1=CCC(C)S1 |
| InChI | InChI=1S/C16H24N2S/c1-6-9-17-11-15(10-13(2)12-18(4)5)16-8-7-14(3)19-16/h6,8,10-12,14H,1,7,9H2,2-5H3/b13-12+,15-10+,17-11+ |
| InChIKey | GMUQALHYRBXMKO-OCKJXOKZSA-N |
| XLogP | 4.04 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.45 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|