About 2,3-bis(ethylsulfanyl)-2,3-bis(phenylsulfanylmethyl)butanedinitrile
2,3-bis(ethylsulfanyl)-2,3-bis(phenylsulfanylmethyl)butanedinitrile (PubChem CID 13441850) has the molecular formula C22H24N2S4
and a molecular weight of 444.72 g/mol. Its IUPAC name is 2,3-bis(ethylsulfanyl)-2,3-bis(phenylsulfanylmethyl)butanedinitrile.
Molecular Properties
| Compound Name | 2,3-bis(ethylsulfanyl)-2,3-bis(phenylsulfanylmethyl)butanedinitrile |
| PubChem CID | 13441850 |
| Molecular Formula | C22H24N2S4 |
| Molecular Weight | 444.72 g/mol |
| Exact Mass | 444.08 |
| IUPAC Name | 2,3-bis(ethylsulfanyl)-2,3-bis(phenylsulfanylmethyl)butanedinitrile |
| SMILES | CCSC(C#N)(CSc1ccccc1)C(C#N)(CSc1ccccc1)SCC |
| InChI | InChI=1S/C22H24N2S4/c1-3-27-21(15-23,17-25-19-11-7-5-8-12-19)22(16-24,28-4-2)18-26-20-13-9-6-10-14-20/h5-14H,3-4,17-18H2,1-2H3 |
| InChIKey | MVHGIYQRSODIAY-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 444.72 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2,3-bis(ethylsulfanyl)-2,3-bis(phenylsulfanylmethyl)butanedinitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-bis(ethylsulfanyl)-2,3-bis(phenylsulfanylmethyl)butanedinitrile?
The IUPAC name of 2,3-bis(ethylsulfanyl)-2,3-bis(phenylsulfanylmethyl)butanedinitrile (CID 13441850) is 2,3-bis(ethylsulfanyl)-2,3-bis(phenylsulfanylmethyl)butanedinitrile.
What is the SMILES notation for 2,3-bis(ethylsulfanyl)-2,3-bis(phenylsulfanylmethyl)butanedinitrile?
The canonical SMILES for 2,3-bis(ethylsulfanyl)-2,3-bis(phenylsulfanylmethyl)butanedinitrile is CCSC(C#N)(CSc1ccccc1)C(C#N)(CSc1ccccc1)SCC.
What is the InChIKey of 2,3-bis(ethylsulfanyl)-2,3-bis(phenylsulfanylmethyl)butanedinitrile?
The InChIKey is MVHGIYQRSODIAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24N2S4/c1-3-27-21(15-23,17-25-19-11-7-5-8-12-19)22(16-24,28-4-2)18-26-20-13-9-6-10-14-20/h5-14H,3-4,17-18H2,1-2H3.
What are the key properties of 2,3-bis(ethylsulfanyl)-2,3-bis(phenylsulfanylmethyl)butanedinitrile?
2,3-bis(ethylsulfanyl)-2,3-bis(phenylsulfanylmethyl)butanedinitrile has a molecular weight of 444.72 g/mol, XLogP of 6.60, 11 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-bis(ethylsulfanyl)-2,3-bis(phenylsulfanylmethyl)butanedinitrile is sourced from PubChem (CID 13441850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).