C22H25NO3 — CID 134418724
3-(3,4-dimethyl-2-nitrosophenyl)-8,8-dimethyl-3,4,9,10-tetrahydro-2H-pyrano[2,3-h]chromene (PubChem CID 134418724) has the molecular formula C22H25NO3 and a molecular weight of 351.45 g/mol. Its IUPAC name is 3-(3,4-dimethyl-2-nitrosophenyl)-8,8-dimethyl-3,4,9,10-tetrahydro-2H-pyrano[2,3-h]chromene.
| Compound Name | 3-(3,4-dimethyl-2-nitrosophenyl)-8,8-dimethyl-3,4,9,10-tetrahydro-2H-pyrano[2,3-h]chromene |
|---|---|
| PubChem CID | 134418724 |
| Molecular Formula | C22H25NO3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | 3-(3,4-dimethyl-2-nitrosophenyl)-8,8-dimethyl-3,4,9,10-tetrahydro-2H-pyrano[2,3-h]chromene |
| SMILES | Cc1ccc(C2COc3c(ccc4c3CCC(C)(C)O4)C2)c(N=O)c1C |
| InChI | InChI=1S/C22H25NO3/c1-13-5-7-17(20(23-24)14(13)2)16-11-15-6-8-19-18(21(15)25-12-16)9-10-22(3,4)26-19/h5-8,16H,9-12H2,1-4H3 |
| InChIKey | VWZSKAJQVMLVNW-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |