C24H30O3 — CID 134419080
5-ethoxy-2-(5,8,8-trimethyl-2,3,4,7,9,10-hexahydrobenzo[h]chromen-3-yl)phenol (PubChem CID 134419080) has the molecular formula C24H30O3 and a molecular weight of 366.50 g/mol. Its IUPAC name is 5-ethoxy-2-(5,8,8-trimethyl-2,3,4,7,9,10-hexahydrobenzo[h]chromen-3-yl)phenol.
| Compound Name | 5-ethoxy-2-(5,8,8-trimethyl-2,3,4,7,9,10-hexahydrobenzo[h]chromen-3-yl)phenol |
|---|---|
| PubChem CID | 134419080 |
| Molecular Formula | C24H30O3 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | 5-ethoxy-2-(5,8,8-trimethyl-2,3,4,7,9,10-hexahydrobenzo[h]chromen-3-yl)phenol |
| SMILES | CCOc1ccc(C2COc3c(c(C)cc4c3CCC(C)(C)C4)C2)c(O)c1 |
| InChI | InChI=1S/C24H30O3/c1-5-26-18-6-7-19(22(25)12-18)17-11-21-15(2)10-16-13-24(3,4)9-8-20(16)23(21)27-14-17/h6-7,10,12,17,25H,5,8-9,11,13-14H2,1-4H3 |
| InChIKey | CNTUEHVEHKOCLE-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |