About 2-(2,2-difluoroethenoxy)-1,3-difluoro-5-(2-fluoro-4-phenylphenyl)benzene
2-(2,2-difluoroethenoxy)-1,3-difluoro-5-(2-fluoro-4-phenylphenyl)benzene (PubChem CID 134419743) has the molecular formula C20H11F5O
and a molecular weight of 362.30 g/mol. Its IUPAC name is 2-(2,2-difluoroethenoxy)-1,3-difluoro-5-(2-fluoro-4-phenylphenyl)benzene.
Molecular Properties
| Compound Name | 2-(2,2-difluoroethenoxy)-1,3-difluoro-5-(2-fluoro-4-phenylphenyl)benzene |
| PubChem CID | 134419743 |
| Molecular Formula | C20H11F5O |
| Molecular Weight | 362.30 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | 2-(2,2-difluoroethenoxy)-1,3-difluoro-5-(2-fluoro-4-phenylphenyl)benzene |
| SMILES | FC(F)=COc1c(F)cc(-c2ccc(-c3ccccc3)cc2F)cc1F |
| InChI | InChI=1S/C20H11F5O/c21-16-8-13(12-4-2-1-3-5-12)6-7-15(16)14-9-17(22)20(18(23)10-14)26-11-19(24)25/h1-11H |
| InChIKey | LMGMBRURXLROEQ-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.30 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,2-difluoroethenoxy)-1,3-difluoro-5-(2-fluoro-4-phenylphenyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2-difluoroethenoxy)-1,3-difluoro-5-(2-fluoro-4-phenylphenyl)benzene?
The IUPAC name of 2-(2,2-difluoroethenoxy)-1,3-difluoro-5-(2-fluoro-4-phenylphenyl)benzene (CID 134419743) is 2-(2,2-difluoroethenoxy)-1,3-difluoro-5-(2-fluoro-4-phenylphenyl)benzene.
What is the SMILES notation for 2-(2,2-difluoroethenoxy)-1,3-difluoro-5-(2-fluoro-4-phenylphenyl)benzene?
The canonical SMILES for 2-(2,2-difluoroethenoxy)-1,3-difluoro-5-(2-fluoro-4-phenylphenyl)benzene is FC(F)=COc1c(F)cc(-c2ccc(-c3ccccc3)cc2F)cc1F.
What is the InChIKey of 2-(2,2-difluoroethenoxy)-1,3-difluoro-5-(2-fluoro-4-phenylphenyl)benzene?
The InChIKey is LMGMBRURXLROEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H11F5O/c21-16-8-13(12-4-2-1-3-5-12)6-7-15(16)14-9-17(22)20(18(23)10-14)26-11-19(24)25/h1-11H.
What are the key properties of 2-(2,2-difluoroethenoxy)-1,3-difluoro-5-(2-fluoro-4-phenylphenyl)benzene?
2-(2,2-difluoroethenoxy)-1,3-difluoro-5-(2-fluoro-4-phenylphenyl)benzene has a molecular weight of 362.30 g/mol, XLogP of 6.55, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-difluoroethenoxy)-1,3-difluoro-5-(2-fluoro-4-phenylphenyl)benzene is sourced from PubChem (CID 134419743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).