C33H34N4O4S — CID 134419752
(4-methyl-3-morpholin-4-ylsulfonylanilino)-[3-(4-methylphenyl)-1-(naphthalen-2-ylmethyl)pyrazol-4-yl]methanol (PubChem CID 134419752) has the molecular formula C33H34N4O4S and a molecular weight of 582.73 g/mol. Its IUPAC name is (4-methyl-3-morpholin-4-ylsulfonylanilino)-[3-(4-methylphenyl)-1-(naphthalen-2-ylmethyl)pyrazol-4-yl]methanol.
| Compound Name | (4-methyl-3-morpholin-4-ylsulfonylanilino)-[3-(4-methylphenyl)-1-(naphthalen-2-ylmethyl)pyrazol-4-yl]methanol |
|---|---|
| PubChem CID | 134419752 |
| Molecular Formula | C33H34N4O4S |
| Molecular Weight | 582.73 g/mol |
| Exact Mass | 582.23 |
| IUPAC Name | (4-methyl-3-morpholin-4-ylsulfonylanilino)-[3-(4-methylphenyl)-1-(naphthalen-2-ylmethyl)pyrazol-4-yl]methanol |
| SMILES | Cc1ccc(-c2nn(Cc3ccc4ccccc4c3)cc2C(O)Nc2ccc(C)c(S(=O)(=O)N3CCOCC3)c2)cc1 |
| InChI | InChI=1S/C33H34N4O4S/c1-23-7-11-27(12-8-23)32-30(22-36(35-32)21-25-10-13-26-5-3-4-6-28(26)19-25)33(38)34-29-14-9-24(2)31(20-29)42(39,40)37-15-17-41-18-16-37/h3-14,19-20,22,33-34,38H,15-18,21H2,1-2H3 |
| InChIKey | SMIPIUPZHJGSCR-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.73 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|