C12H20N2O — CID 134419914
1-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]-3-propan-2-ylurea (PubChem CID 134419914) has the molecular formula C12H20N2O and a molecular weight of 208.31 g/mol. Its IUPAC name is 1-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]-3-propan-2-ylurea.
| Compound Name | 1-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 134419914 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 1-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]-3-propan-2-ylurea |
| SMILES | C/C=C\C=C(/C=C\C)NC(=O)NC(C)C |
| InChI | InChI=1S/C12H20N2O/c1-5-7-9-11(8-6-2)14-12(15)13-10(3)4/h5-10H,1-4H3,(H2,13,14,15)/b7-5-,8-6-,11-9+ |
| InChIKey | CXOHBPUFOOVRBC-JDDXFTJCSA-N |
| XLogP | 2.73 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|