C13H20N2 — CID 134419919
(1Z,3E)-4-(ethenyliminomethyl)-3-ethyl-2-methylhepta-1,3,6-trien-1-amine (PubChem CID 134419919) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is (1Z,3E)-4-(ethenyliminomethyl)-3-ethyl-2-methylhepta-1,3,6-trien-1-amine.
| Compound Name | (1Z,3E)-4-(ethenyliminomethyl)-3-ethyl-2-methylhepta-1,3,6-trien-1-amine |
|---|---|
| PubChem CID | 134419919 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | (1Z,3E)-4-(ethenyliminomethyl)-3-ethyl-2-methylhepta-1,3,6-trien-1-amine |
| SMILES | C=CCC(/C=N/C=C)=C(CC)\C(C)=C/N |
| InChI | InChI=1S/C13H20N2/c1-5-8-12(10-15-7-3)13(6-2)11(4)9-14/h5,7,9-10H,1,3,6,8,14H2,2,4H3/b11-9-,13-12+,15-10+ |
| InChIKey | MBZNNXYTJIXSPA-XVHUGHIOSA-N |
| XLogP | 3.35 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|