C13H20N2 — CID 134419995
(3E,5Z)-4-ethyl-5-methyl-3-(methyliminomethyl)octa-1,3,5,7-tetraen-2-amine (PubChem CID 134419995) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is (3E,5Z)-4-ethyl-5-methyl-3-(methyliminomethyl)octa-1,3,5,7-tetraen-2-amine.
| Compound Name | (3E,5Z)-4-ethyl-5-methyl-3-(methyliminomethyl)octa-1,3,5,7-tetraen-2-amine |
|---|---|
| PubChem CID | 134419995 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | (3E,5Z)-4-ethyl-5-methyl-3-(methyliminomethyl)octa-1,3,5,7-tetraen-2-amine |
| SMILES | C=C/C=C(C)\C(CC)=C(\C=N\C)C(=C)N |
| InChI | InChI=1S/C13H20N2/c1-6-8-10(3)12(7-2)13(9-15-5)11(4)14/h6,8-9H,1,4,7,14H2,2-3,5H3/b10-8-,13-12-,15-9+ |
| InChIKey | XKSYPCXCKDEHDK-DYCXAJGZSA-N |
| XLogP | 3.00 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|