C21H22N2 — CID 134420160
3,6-bis[(1Z)-buta-1,3-dienyl]-N,1,4,5-tetrakis(ethenyl)pyridin-2-imine (PubChem CID 134420160) has the molecular formula C21H22N2 and a molecular weight of 302.42 g/mol. Its IUPAC name is 3,6-bis[(1Z)-buta-1,3-dienyl]-N,1,4,5-tetrakis(ethenyl)pyridin-2-imine.
| Compound Name | 3,6-bis[(1Z)-buta-1,3-dienyl]-N,1,4,5-tetrakis(ethenyl)pyridin-2-imine |
|---|---|
| PubChem CID | 134420160 |
| Molecular Formula | C21H22N2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | 3,6-bis[(1Z)-buta-1,3-dienyl]-N,1,4,5-tetrakis(ethenyl)pyridin-2-imine |
| SMILES | C=C/C=C\c1c(C=C)c(C=C)c(/C=C\C=C)n(C=C)/c1=N\C=C |
| InChI | InChI=1S/C21H22N2/c1-7-13-15-19-17(9-3)18(10-4)20(16-14-8-2)23(12-6)21(19)22-11-5/h7-16H,1-6H2/b15-13-,16-14-,22-21- |
| InChIKey | DTSHNBJVZOQWPH-ZILZRECQSA-N |
| XLogP | 5.32 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|