C17H36N2 — CID 134420545
5-N,7-dimethyl-6-methylidene-1-N,5-N-di(propan-2-yl)octane-1,5-diamine (PubChem CID 134420545) has the molecular formula C17H36N2 and a molecular weight of 268.49 g/mol. Its IUPAC name is 5-N,7-dimethyl-6-methylidene-1-N,5-N-di(propan-2-yl)octane-1,5-diamine.
| Compound Name | 5-N,7-dimethyl-6-methylidene-1-N,5-N-di(propan-2-yl)octane-1,5-diamine |
|---|---|
| PubChem CID | 134420545 |
| Molecular Formula | C17H36N2 |
| Molecular Weight | 268.49 g/mol |
| Exact Mass | 268.29 |
| IUPAC Name | 5-N,7-dimethyl-6-methylidene-1-N,5-N-di(propan-2-yl)octane-1,5-diamine |
| SMILES | C=C(C(C)C)C(CCCCNC(C)C)N(C)C(C)C |
| InChI | InChI=1S/C17H36N2/c1-13(2)16(7)17(19(8)15(5)6)11-9-10-12-18-14(3)4/h13-15,17-18H,7,9-12H2,1-6,8H3 |
| InChIKey | VXGTXXSRMNYAEN-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.49 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|