C6H8F6O — CID 13442056
3,3,4,5,5,5-hexafluoro-2-methylpentan-2-ol (PubChem CID 13442056) has the molecular formula C6H8F6O and a molecular weight of 210.12 g/mol. Its IUPAC name is 3,3,4,5,5,5-hexafluoro-2-methylpentan-2-ol.
| Compound Name | 3,3,4,5,5,5-hexafluoro-2-methylpentan-2-ol |
|---|---|
| PubChem CID | 13442056 |
| Molecular Formula | C6H8F6O |
| Molecular Weight | 210.12 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | 3,3,4,5,5,5-hexafluoro-2-methylpentan-2-ol |
| SMILES | CC(C)(O)C(F)(F)C(F)C(F)(F)F |
| InChI | InChI=1S/C6H8F6O/c1-4(2,13)5(8,9)3(7)6(10,11)12/h3,13H,1-2H3 |
| InChIKey | AHOBFJZDSQJNCO-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.12 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |