C24H29F3N6O3 — CID 134420565
1-acetyl-N-[2-[(2E,4E)-2,4-dimethyl-5-(methylideneamino)-5-(2,2,2-trifluoroethoxy)penta-2,4-dienyl]pyrazolo[4,3-c]pyridin-4-yl]piperidine-4-carboxamide (PubChem CID 134420565) has the molecular formula C24H29F3N6O3 and a molecular weight of 506.53 g/mol. Its IUPAC name is 1-acetyl-N-[2-[(2E,4E)-2,4-dimethyl-5-(methylideneamino)-5-(2,2,2-trifluoroethoxy)penta-2,4-dienyl]pyrazolo[4,3-c]pyridin-4-yl]piperidine-4-carboxamide.
| Compound Name | 1-acetyl-N-[2-[(2E,4E)-2,4-dimethyl-5-(methylideneamino)-5-(2,2,2-trifluoroethoxy)penta-2,4-dienyl]pyrazolo[4,3-c]pyridin-4-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 134420565 |
| Molecular Formula | C24H29F3N6O3 |
| Molecular Weight | 506.53 g/mol |
| Exact Mass | 506.23 |
| IUPAC Name | 1-acetyl-N-[2-[(2E,4E)-2,4-dimethyl-5-(methylideneamino)-5-(2,2,2-trifluoroethoxy)penta-2,4-dienyl]pyrazolo[4,3-c]pyridin-4-yl]piperidine-4-carboxamide |
| SMILES | C=N/C(OCC(F)(F)F)=C(C)\C=C(/C)Cn1cc2c(NC(=O)C3CCN(C(C)=O)CC3)nccc2n1 |
| InChI | InChI=1S/C24H29F3N6O3/c1-15(11-16(2)23(28-4)36-14-24(25,26)27)12-33-13-19-20(31-33)5-8-29-21(19)30-22(35)18-6-9-32(10-7-18)17(3)34/h5,8,11,13,18H,4,6-7,9-10,12,14H2,1-3H3,(H,29,30,35)/b15-11+,23-16+ |
| InChIKey | JNOVCGOOZSBCBJ-DJKNNIRCSA-N |
| XLogP | 4.09 |
| TPSA | 101.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.53 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|