About 1-[(2R,5R)-2-ethenyl-3-azabicyclo[3.1.0]hexan-3-yl]-3-methylbutan-1-one
1-[(2R,5R)-2-ethenyl-3-azabicyclo[3.1.0]hexan-3-yl]-3-methylbutan-1-one (PubChem CID 134421622) has the molecular formula C12H19NO
and a molecular weight of 193.29 g/mol. Its IUPAC name is 1-[(2R,5R)-2-ethenyl-3-azabicyclo[3.1.0]hexan-3-yl]-3-methylbutan-1-one.
Molecular Properties
| Compound Name | 1-[(2R,5R)-2-ethenyl-3-azabicyclo[3.1.0]hexan-3-yl]-3-methylbutan-1-one |
| PubChem CID | 134421622 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 1-[(2R,5R)-2-ethenyl-3-azabicyclo[3.1.0]hexan-3-yl]-3-methylbutan-1-one |
| SMILES | C=C[C@@H]1C2C[C@H]2CN1C(=O)CC(C)C |
| InChI | InChI=1S/C12H19NO/c1-4-11-10-6-9(10)7-13(11)12(14)5-8(2)3/h4,8-11H,1,5-7H2,2-3H3/t9-,10?,11+/m0/s1 |
| InChIKey | XMOVSDWRRFIITP-KHUXNXPUSA-N |
| XLogP | 2.07 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2R,5R)-2-ethenyl-3-azabicyclo[3.1.0]hexan-3-yl]-3-methylbutan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2R,5R)-2-ethenyl-3-azabicyclo[3.1.0]hexan-3-yl]-3-methylbutan-1-one?
The IUPAC name of 1-[(2R,5R)-2-ethenyl-3-azabicyclo[3.1.0]hexan-3-yl]-3-methylbutan-1-one (CID 134421622) is 1-[(2R,5R)-2-ethenyl-3-azabicyclo[3.1.0]hexan-3-yl]-3-methylbutan-1-one.
What is the SMILES notation for 1-[(2R,5R)-2-ethenyl-3-azabicyclo[3.1.0]hexan-3-yl]-3-methylbutan-1-one?
The canonical SMILES for 1-[(2R,5R)-2-ethenyl-3-azabicyclo[3.1.0]hexan-3-yl]-3-methylbutan-1-one is C=C[C@@H]1C2C[C@H]2CN1C(=O)CC(C)C.
What is the InChIKey of 1-[(2R,5R)-2-ethenyl-3-azabicyclo[3.1.0]hexan-3-yl]-3-methylbutan-1-one?
The InChIKey is XMOVSDWRRFIITP-KHUXNXPUSA-N. The full InChI is InChI=1S/C12H19NO/c1-4-11-10-6-9(10)7-13(11)12(14)5-8(2)3/h4,8-11H,1,5-7H2,2-3H3/t9-,10?,11+/m0/s1.
What are the key properties of 1-[(2R,5R)-2-ethenyl-3-azabicyclo[3.1.0]hexan-3-yl]-3-methylbutan-1-one?
1-[(2R,5R)-2-ethenyl-3-azabicyclo[3.1.0]hexan-3-yl]-3-methylbutan-1-one has a molecular weight of 193.29 g/mol, XLogP of 2.07, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2R,5R)-2-ethenyl-3-azabicyclo[3.1.0]hexan-3-yl]-3-methylbutan-1-one is sourced from PubChem (CID 134421622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).