About 3-(cyclohepta-2,4,6-trien-1-ylmethyl)-4-methyl-N-[(Z)-prop-1-enyl]pentan-2-imine
3-(cyclohepta-2,4,6-trien-1-ylmethyl)-4-methyl-N-[(Z)-prop-1-enyl]pentan-2-imine (PubChem CID 134421822) has the molecular formula C17H25N
and a molecular weight of 243.39 g/mol. Its IUPAC name is 3-(cyclohepta-2,4,6-trien-1-ylmethyl)-4-methyl-N-[(Z)-prop-1-enyl]pentan-2-imine.
Molecular Properties
| Compound Name | 3-(cyclohepta-2,4,6-trien-1-ylmethyl)-4-methyl-N-[(Z)-prop-1-enyl]pentan-2-imine |
| PubChem CID | 134421822 |
| Molecular Formula | C17H25N |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.20 |
| IUPAC Name | 3-(cyclohepta-2,4,6-trien-1-ylmethyl)-4-methyl-N-[(Z)-prop-1-enyl]pentan-2-imine |
| SMILES | C/C=C\N=C(/C)C(CC1C=CC=CC=C1)C(C)C |
| InChI | InChI=1S/C17H25N/c1-5-12-18-15(4)17(14(2)3)13-16-10-8-6-7-9-11-16/h5-12,14,16-17H,13H2,1-4H3/b12-5-,18-15+ |
| InChIKey | PPVYNEATEAEOSB-JSIQHARMSA-N |
| XLogP | 4.94 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(cyclohepta-2,4,6-trien-1-ylmethyl)-4-methyl-N-[(Z)-prop-1-enyl]pentan-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(cyclohepta-2,4,6-trien-1-ylmethyl)-4-methyl-N-[(Z)-prop-1-enyl]pentan-2-imine?
The IUPAC name of 3-(cyclohepta-2,4,6-trien-1-ylmethyl)-4-methyl-N-[(Z)-prop-1-enyl]pentan-2-imine (CID 134421822) is 3-(cyclohepta-2,4,6-trien-1-ylmethyl)-4-methyl-N-[(Z)-prop-1-enyl]pentan-2-imine.
What is the SMILES notation for 3-(cyclohepta-2,4,6-trien-1-ylmethyl)-4-methyl-N-[(Z)-prop-1-enyl]pentan-2-imine?
The canonical SMILES for 3-(cyclohepta-2,4,6-trien-1-ylmethyl)-4-methyl-N-[(Z)-prop-1-enyl]pentan-2-imine is C/C=C\N=C(/C)C(CC1C=CC=CC=C1)C(C)C.
What is the InChIKey of 3-(cyclohepta-2,4,6-trien-1-ylmethyl)-4-methyl-N-[(Z)-prop-1-enyl]pentan-2-imine?
The InChIKey is PPVYNEATEAEOSB-JSIQHARMSA-N. The full InChI is InChI=1S/C17H25N/c1-5-12-18-15(4)17(14(2)3)13-16-10-8-6-7-9-11-16/h5-12,14,16-17H,13H2,1-4H3/b12-5-,18-15+.
What are the key properties of 3-(cyclohepta-2,4,6-trien-1-ylmethyl)-4-methyl-N-[(Z)-prop-1-enyl]pentan-2-imine?
3-(cyclohepta-2,4,6-trien-1-ylmethyl)-4-methyl-N-[(Z)-prop-1-enyl]pentan-2-imine has a molecular weight of 243.39 g/mol, XLogP of 4.94, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(cyclohepta-2,4,6-trien-1-ylmethyl)-4-methyl-N-[(Z)-prop-1-enyl]pentan-2-imine is sourced from PubChem (CID 134421822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).