C21H32N2 — CID 134421910
(2Z,4Z)-2-N-[(3Z,5Z)-3-ethenyl-5-propan-2-ylhepta-1,3,5-trien-2-yl]-3-N,6-dimethylhepta-2,4,6-triene-2,3-diamine (PubChem CID 134421910) has the molecular formula C21H32N2 and a molecular weight of 312.50 g/mol. Its IUPAC name is (2Z,4Z)-2-N-[(3Z,5Z)-3-ethenyl-5-propan-2-ylhepta-1,3,5-trien-2-yl]-3-N,6-dimethylhepta-2,4,6-triene-2,3-diamine.
| Compound Name | (2Z,4Z)-2-N-[(3Z,5Z)-3-ethenyl-5-propan-2-ylhepta-1,3,5-trien-2-yl]-3-N,6-dimethylhepta-2,4,6-triene-2,3-diamine |
|---|---|
| PubChem CID | 134421910 |
| Molecular Formula | C21H32N2 |
| Molecular Weight | 312.50 g/mol |
| Exact Mass | 312.26 |
| IUPAC Name | (2Z,4Z)-2-N-[(3Z,5Z)-3-ethenyl-5-propan-2-ylhepta-1,3,5-trien-2-yl]-3-N,6-dimethylhepta-2,4,6-triene-2,3-diamine |
| SMILES | C=C/C(=C/C(=C\C)C(C)C)C(=C)N/C(C)=C(/C=C\C(=C)C)NC |
| InChI | InChI=1S/C21H32N2/c1-10-19(16(5)6)14-20(11-2)17(7)23-18(8)21(22-9)13-12-15(3)4/h10-14,16,22-23H,2-3,7H2,1,4-6,8-9H3/b13-12-,19-10+,20-14-,21-18- |
| InChIKey | NSTMXZHYFMOOHP-VCTUIPBKSA-N |
| XLogP | 5.39 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.50 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|