C9H3Cl3N2O2S — CID 13442291
2-(2-amino-1,3-thiazol-5-yl)-3,5,6-trichlorocyclohexa-2,5-diene-1,4-dione (PubChem CID 13442291) has the molecular formula C9H3Cl3N2O2S and a molecular weight of 309.56 g/mol. Its IUPAC name is 2-(2-amino-1,3-thiazol-5-yl)-3,5,6-trichlorocyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-(2-amino-1,3-thiazol-5-yl)-3,5,6-trichlorocyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 13442291 |
| Molecular Formula | C9H3Cl3N2O2S |
| Molecular Weight | 309.56 g/mol |
| Exact Mass | 307.90 |
| IUPAC Name | 2-(2-amino-1,3-thiazol-5-yl)-3,5,6-trichlorocyclohexa-2,5-diene-1,4-dione |
| SMILES | Nc1ncc(C2=C(Cl)C(=O)C(Cl)=C(Cl)C2=O)s1 |
| InChI | InChI=1S/C9H3Cl3N2O2S/c10-4-3(2-1-14-9(13)17-2)7(15)5(11)6(12)8(4)16/h1H,(H2,13,14) |
| InChIKey | WRRGTJFFNQITGH-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.56 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|