C12H7Cl3N2O2S — CID 13442296
2,3,5-trichloro-6-[2-(prop-2-enylamino)-1,3-thiazol-5-yl]cyclohexa-2,5-diene-1,4-dione (PubChem CID 13442296) has the molecular formula C12H7Cl3N2O2S and a molecular weight of 349.63 g/mol. Its IUPAC name is 2,3,5-trichloro-6-[2-(prop-2-enylamino)-1,3-thiazol-5-yl]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,3,5-trichloro-6-[2-(prop-2-enylamino)-1,3-thiazol-5-yl]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 13442296 |
| Molecular Formula | C12H7Cl3N2O2S |
| Molecular Weight | 349.63 g/mol |
| Exact Mass | 347.93 |
| IUPAC Name | 2,3,5-trichloro-6-[2-(prop-2-enylamino)-1,3-thiazol-5-yl]cyclohexa-2,5-diene-1,4-dione |
| SMILES | C=CCNc1ncc(C2=C(Cl)C(=O)C(Cl)=C(Cl)C2=O)s1 |
| InChI | InChI=1S/C12H7Cl3N2O2S/c1-2-3-16-12-17-4-5(20-12)6-7(13)11(19)9(15)8(14)10(6)18/h2,4H,1,3H2,(H,16,17) |
| InChIKey | DXEZOBURHMSKPF-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.63 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|