C18H20ClN9O2S2 — CID 134422999
N,N'-diamino-N-[4-[5-[5-[(5S)-3-amino-2,5-dimethyl-1-oxo-6H-1,2,4-thiadiazin-5-yl]-4-chlorothiophen-2-yl]-1,3,4-oxadiazol-2-yl]phenyl]methanimidamide (PubChem CID 134422999) has the molecular formula C18H20ClN9O2S2 and a molecular weight of 494.01 g/mol. Its IUPAC name is N,N'-diamino-N-[4-[5-[5-[(5S)-3-amino-2,5-dimethyl-1-oxo-6H-1,2,4-thiadiazin-5-yl]-4-chlorothiophen-2-yl]-1,3,4-oxadiazol-2-yl]phenyl]methanimidamide.
| Compound Name | N,N'-diamino-N-[4-[5-[5-[(5S)-3-amino-2,5-dimethyl-1-oxo-6H-1,2,4-thiadiazin-5-yl]-4-chlorothiophen-2-yl]-1,3,4-oxadiazol-2-yl]phenyl]methanimidamide |
|---|---|
| PubChem CID | 134422999 |
| Molecular Formula | C18H20ClN9O2S2 |
| Molecular Weight | 494.01 g/mol |
| Exact Mass | 493.09 |
| IUPAC Name | N,N'-diamino-N-[4-[5-[5-[(5S)-3-amino-2,5-dimethyl-1-oxo-6H-1,2,4-thiadiazin-5-yl]-4-chlorothiophen-2-yl]-1,3,4-oxadiazol-2-yl]phenyl]methanimidamide |
| SMILES | CN1C(N)=N[C@](C)(c2sc(-c3nnc(-c4ccc(N(N)/C=N\N)cc4)o3)cc2Cl)CS1=O |
| InChI | InChI=1S/C18H20ClN9O2S2/c1-18(8-32(29)27(2)17(20)24-18)14-12(19)7-13(31-14)16-26-25-15(30-16)10-3-5-11(6-4-10)28(22)9-23-21/h3-7,9H,8,21-22H2,1-2H3,(H2,20,24)/b23-9-/t18-,32?/m0/s1 |
| InChIKey | QQJMMHPZMYSNFF-LUDBUPJSSA-N |
| XLogP | 1.84 |
| TPSA | 165.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.01 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|