C22H25ClN6O2S2 — CID 134423050
(5S)-5-[3-chloro-5-[5-(4-piperidin-1-ylphenyl)-1,3,4-oxadiazol-2-yl]thiophen-2-yl]-2,5-dimethyl-1-oxo-6H-1,2,4-thiadiazin-3-amine (PubChem CID 134423050) has the molecular formula C22H25ClN6O2S2 and a molecular weight of 505.07 g/mol. Its IUPAC name is (5S)-5-[3-chloro-5-[5-(4-piperidin-1-ylphenyl)-1,3,4-oxadiazol-2-yl]thiophen-2-yl]-2,5-dimethyl-1-oxo-6H-1,2,4-thiadiazin-3-amine.
| Compound Name | (5S)-5-[3-chloro-5-[5-(4-piperidin-1-ylphenyl)-1,3,4-oxadiazol-2-yl]thiophen-2-yl]-2,5-dimethyl-1-oxo-6H-1,2,4-thiadiazin-3-amine |
|---|---|
| PubChem CID | 134423050 |
| Molecular Formula | C22H25ClN6O2S2 |
| Molecular Weight | 505.07 g/mol |
| Exact Mass | 504.12 |
| IUPAC Name | (5S)-5-[3-chloro-5-[5-(4-piperidin-1-ylphenyl)-1,3,4-oxadiazol-2-yl]thiophen-2-yl]-2,5-dimethyl-1-oxo-6H-1,2,4-thiadiazin-3-amine |
| SMILES | CN1C(N)=N[C@](C)(c2sc(-c3nnc(-c4ccc(N5CCCCC5)cc4)o3)cc2Cl)CS1=O |
| InChI | InChI=1S/C22H25ClN6O2S2/c1-22(13-33(30)28(2)21(24)25-22)18-16(23)12-17(32-18)20-27-26-19(31-20)14-6-8-15(9-7-14)29-10-4-3-5-11-29/h6-9,12H,3-5,10-11,13H2,1-2H3,(H2,24,25)/t22-,33?/m0/s1 |
| InChIKey | FQZYZLZMFLKESX-LJPZCQIFSA-N |
| XLogP | 4.25 |
| TPSA | 100.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.07 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |