C14H22O6 — CID 134423314
6-(2,2-dimethyl-1,3-dioxolan-4-yl)-3a-ethyl-2,2-dimethyl-6,6a-dihydrofuro[3,4-d][1,3]dioxol-4-one (PubChem CID 134423314) has the molecular formula C14H22O6 and a molecular weight of 286.32 g/mol. Its IUPAC name is 6-(2,2-dimethyl-1,3-dioxolan-4-yl)-3a-ethyl-2,2-dimethyl-6,6a-dihydrofuro[3,4-d][1,3]dioxol-4-one.
| Compound Name | 6-(2,2-dimethyl-1,3-dioxolan-4-yl)-3a-ethyl-2,2-dimethyl-6,6a-dihydrofuro[3,4-d][1,3]dioxol-4-one |
|---|---|
| PubChem CID | 134423314 |
| Molecular Formula | C14H22O6 |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 6-(2,2-dimethyl-1,3-dioxolan-4-yl)-3a-ethyl-2,2-dimethyl-6,6a-dihydrofuro[3,4-d][1,3]dioxol-4-one |
| SMILES | CCC12OC(C)(C)OC1C(C1COC(C)(C)O1)OC2=O |
| InChI | InChI=1S/C14H22O6/c1-6-14-10(19-13(4,5)20-14)9(17-11(14)15)8-7-16-12(2,3)18-8/h8-10H,6-7H2,1-5H3 |
| InChIKey | WWALNHGDHXHYSS-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |