C29H54F2N2 — CID 134423406
(3Z)-4-N',6-diethyl-3-[[2-fluoro-4-(5-fluorooctan-4-yl)cyclohexyl]methylidene]-5-methylnon-8-ene-4,4-diamine (PubChem CID 134423406) has the molecular formula C29H54F2N2 and a molecular weight of 468.76 g/mol. Its IUPAC name is (3Z)-4-N',6-diethyl-3-[[2-fluoro-4-(5-fluorooctan-4-yl)cyclohexyl]methylidene]-5-methylnon-8-ene-4,4-diamine.
| Compound Name | (3Z)-4-N',6-diethyl-3-[[2-fluoro-4-(5-fluorooctan-4-yl)cyclohexyl]methylidene]-5-methylnon-8-ene-4,4-diamine |
|---|---|
| PubChem CID | 134423406 |
| Molecular Formula | C29H54F2N2 |
| Molecular Weight | 468.76 g/mol |
| Exact Mass | 468.43 |
| IUPAC Name | (3Z)-4-N',6-diethyl-3-[[2-fluoro-4-(5-fluorooctan-4-yl)cyclohexyl]methylidene]-5-methylnon-8-ene-4,4-diamine |
| SMILES | C=CCC(CC)C(C)C(N)(NCC)/C(=C\C1CCC(C(CCC)C(F)CCC)CC1F)CC |
| InChI | InChI=1S/C29H54F2N2/c1-8-14-22(11-4)21(7)29(32,33-13-6)25(12-5)19-24-18-17-23(20-28(24)31)26(15-9-2)27(30)16-10-3/h8,19,21-24,26-28,33H,1,9-18,20,32H2,2-7H3/b25-19- |
| InChIKey | LRXGLMGLEFFAJR-PLRJNAJWSA-N |
| XLogP | 8.13 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.76 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|