About N'-ethyl-N-(3-ethyl-4-methylpentyl)-N'-[(Z)-hept-5-enyl]methanediamine
N'-ethyl-N-(3-ethyl-4-methylpentyl)-N'-[(Z)-hept-5-enyl]methanediamine (PubChem CID 134423593) has the molecular formula C18H38N2
and a molecular weight of 282.52 g/mol. Its IUPAC name is N'-ethyl-N-(3-ethyl-4-methylpentyl)-N'-[(Z)-hept-5-enyl]methanediamine.
Molecular Properties
| Compound Name | N'-ethyl-N-(3-ethyl-4-methylpentyl)-N'-[(Z)-hept-5-enyl]methanediamine |
| PubChem CID | 134423593 |
| Molecular Formula | C18H38N2 |
| Molecular Weight | 282.52 g/mol |
| Exact Mass | 282.30 |
| IUPAC Name | N'-ethyl-N-(3-ethyl-4-methylpentyl)-N'-[(Z)-hept-5-enyl]methanediamine |
| SMILES | C/C=C\CCCCN(CC)CNCCC(CC)C(C)C |
| InChI | InChI=1S/C18H38N2/c1-6-9-10-11-12-15-20(8-3)16-19-14-13-18(7-2)17(4)5/h6,9,17-19H,7-8,10-16H2,1-5H3/b9-6- |
| InChIKey | NVJQCUHATYQBNM-TWGQIWQCSA-N |
| XLogP | 4.67 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.52 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N'-ethyl-N-(3-ethyl-4-methylpentyl)-N'-[(Z)-hept-5-enyl]methanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-ethyl-N-(3-ethyl-4-methylpentyl)-N'-[(Z)-hept-5-enyl]methanediamine?
The IUPAC name of N'-ethyl-N-(3-ethyl-4-methylpentyl)-N'-[(Z)-hept-5-enyl]methanediamine (CID 134423593) is N'-ethyl-N-(3-ethyl-4-methylpentyl)-N'-[(Z)-hept-5-enyl]methanediamine.
What is the SMILES notation for N'-ethyl-N-(3-ethyl-4-methylpentyl)-N'-[(Z)-hept-5-enyl]methanediamine?
The canonical SMILES for N'-ethyl-N-(3-ethyl-4-methylpentyl)-N'-[(Z)-hept-5-enyl]methanediamine is C/C=C\CCCCN(CC)CNCCC(CC)C(C)C.
What is the InChIKey of N'-ethyl-N-(3-ethyl-4-methylpentyl)-N'-[(Z)-hept-5-enyl]methanediamine?
The InChIKey is NVJQCUHATYQBNM-TWGQIWQCSA-N. The full InChI is InChI=1S/C18H38N2/c1-6-9-10-11-12-15-20(8-3)16-19-14-13-18(7-2)17(4)5/h6,9,17-19H,7-8,10-16H2,1-5H3/b9-6-.
What are the key properties of N'-ethyl-N-(3-ethyl-4-methylpentyl)-N'-[(Z)-hept-5-enyl]methanediamine?
N'-ethyl-N-(3-ethyl-4-methylpentyl)-N'-[(Z)-hept-5-enyl]methanediamine has a molecular weight of 282.52 g/mol, XLogP of 4.67, 13 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-ethyl-N-(3-ethyl-4-methylpentyl)-N'-[(Z)-hept-5-enyl]methanediamine is sourced from PubChem (CID 134423593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).