About N-[(Z)-1-(cyclopenten-1-yl)prop-1-enyl]-N'-methylethanimidamide
N-[(Z)-1-(cyclopenten-1-yl)prop-1-enyl]-N'-methylethanimidamide (PubChem CID 134424189) has the molecular formula C11H18N2
and a molecular weight of 178.28 g/mol. Its IUPAC name is N-[(Z)-1-(cyclopenten-1-yl)prop-1-enyl]-N'-methylethanimidamide.
Molecular Properties
| Compound Name | N-[(Z)-1-(cyclopenten-1-yl)prop-1-enyl]-N'-methylethanimidamide |
| PubChem CID | 134424189 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | N-[(Z)-1-(cyclopenten-1-yl)prop-1-enyl]-N'-methylethanimidamide |
| SMILES | C/C=C(\N/C(C)=N/C)C1=CCCC1 |
| InChI | InChI=1S/C11H18N2/c1-4-11(13-9(2)12-3)10-7-5-6-8-10/h4,7H,5-6,8H2,1-3H3,(H,12,13)/b11-4- |
| InChIKey | QPSCWDBLKUEKIW-WCIBSUBMSA-N |
| XLogP | 2.64 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-1-(cyclopenten-1-yl)prop-1-enyl]-N'-methylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-1-(cyclopenten-1-yl)prop-1-enyl]-N'-methylethanimidamide?
The IUPAC name of N-[(Z)-1-(cyclopenten-1-yl)prop-1-enyl]-N'-methylethanimidamide (CID 134424189) is N-[(Z)-1-(cyclopenten-1-yl)prop-1-enyl]-N'-methylethanimidamide.
What is the SMILES notation for N-[(Z)-1-(cyclopenten-1-yl)prop-1-enyl]-N'-methylethanimidamide?
The canonical SMILES for N-[(Z)-1-(cyclopenten-1-yl)prop-1-enyl]-N'-methylethanimidamide is C/C=C(\N/C(C)=N/C)C1=CCCC1.
What is the InChIKey of N-[(Z)-1-(cyclopenten-1-yl)prop-1-enyl]-N'-methylethanimidamide?
The InChIKey is QPSCWDBLKUEKIW-WCIBSUBMSA-N. The full InChI is InChI=1S/C11H18N2/c1-4-11(13-9(2)12-3)10-7-5-6-8-10/h4,7H,5-6,8H2,1-3H3,(H,12,13)/b11-4-.
What are the key properties of N-[(Z)-1-(cyclopenten-1-yl)prop-1-enyl]-N'-methylethanimidamide?
N-[(Z)-1-(cyclopenten-1-yl)prop-1-enyl]-N'-methylethanimidamide has a molecular weight of 178.28 g/mol, XLogP of 2.64, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-1-(cyclopenten-1-yl)prop-1-enyl]-N'-methylethanimidamide is sourced from PubChem (CID 134424189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).