C14H22FN3 — CID 134424280
5-ethyl-1-[(3Z,5E)-5-fluorohepta-1,3,5-trien-2-yl]-N,2-dimethyl-3H-pyrazol-4-amine (PubChem CID 134424280) has the molecular formula C14H22FN3 and a molecular weight of 251.35 g/mol. Its IUPAC name is 5-ethyl-1-[(3Z,5E)-5-fluorohepta-1,3,5-trien-2-yl]-N,2-dimethyl-3H-pyrazol-4-amine.
| Compound Name | 5-ethyl-1-[(3Z,5E)-5-fluorohepta-1,3,5-trien-2-yl]-N,2-dimethyl-3H-pyrazol-4-amine |
|---|---|
| PubChem CID | 134424280 |
| Molecular Formula | C14H22FN3 |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.18 |
| IUPAC Name | 5-ethyl-1-[(3Z,5E)-5-fluorohepta-1,3,5-trien-2-yl]-N,2-dimethyl-3H-pyrazol-4-amine |
| SMILES | C=C(/C=C\C(F)=C/C)N1C(CC)=C(NC)CN1C |
| InChI | InChI=1S/C14H22FN3/c1-6-12(15)9-8-11(3)18-14(7-2)13(16-4)10-17(18)5/h6,8-9,16H,3,7,10H2,1-2,4-5H3/b9-8-,12-6+ |
| InChIKey | KNRQODKRQRTZGA-HQBPLYTQSA-N |
| XLogP | 2.93 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|