C7H10FN — CID 134424317
6-ethenyl-5-fluoro-1,2,3,6-tetrahydropyridine (PubChem CID 134424317) has the molecular formula C7H10FN and a molecular weight of 127.16 g/mol. Its IUPAC name is 6-ethenyl-5-fluoro-1,2,3,6-tetrahydropyridine.
| Compound Name | 6-ethenyl-5-fluoro-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 134424317 |
| Molecular Formula | C7H10FN |
| Molecular Weight | 127.16 g/mol |
| Exact Mass | 127.08 |
| IUPAC Name | 6-ethenyl-5-fluoro-1,2,3,6-tetrahydropyridine |
| SMILES | C=CC1NCCC=C1F |
| InChI | InChI=1S/C7H10FN/c1-2-7-6(8)4-3-5-9-7/h2,4,7,9H,1,3,5H2 |
| InChIKey | RUJFELKKUNBZEQ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.16 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|