About (E)-3-ethyl-N,2-dimethyloct-2-en-1-imine
(E)-3-ethyl-N,2-dimethyloct-2-en-1-imine (PubChem CID 134424328) has the molecular formula C12H23N
and a molecular weight of 181.32 g/mol. Its IUPAC name is (E)-3-ethyl-N,2-dimethyloct-2-en-1-imine.
Molecular Properties
| Compound Name | (E)-3-ethyl-N,2-dimethyloct-2-en-1-imine |
| PubChem CID | 134424328 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | (E)-3-ethyl-N,2-dimethyloct-2-en-1-imine |
| SMILES | CCCCC/C(CC)=C(C)/C=N/C |
| InChI | InChI=1S/C12H23N/c1-5-7-8-9-12(6-2)11(3)10-13-4/h10H,5-9H2,1-4H3/b12-11+,13-10+ |
| InChIKey | VGKGNQDYLBRSQD-JASOSIDASA-N |
| XLogP | 3.99 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-ethyl-N,2-dimethyloct-2-en-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-ethyl-N,2-dimethyloct-2-en-1-imine?
The IUPAC name of (E)-3-ethyl-N,2-dimethyloct-2-en-1-imine (CID 134424328) is (E)-3-ethyl-N,2-dimethyloct-2-en-1-imine.
What is the SMILES notation for (E)-3-ethyl-N,2-dimethyloct-2-en-1-imine?
The canonical SMILES for (E)-3-ethyl-N,2-dimethyloct-2-en-1-imine is CCCCC/C(CC)=C(C)/C=N/C.
What is the InChIKey of (E)-3-ethyl-N,2-dimethyloct-2-en-1-imine?
The InChIKey is VGKGNQDYLBRSQD-JASOSIDASA-N. The full InChI is InChI=1S/C12H23N/c1-5-7-8-9-12(6-2)11(3)10-13-4/h10H,5-9H2,1-4H3/b12-11+,13-10+.
What are the key properties of (E)-3-ethyl-N,2-dimethyloct-2-en-1-imine?
(E)-3-ethyl-N,2-dimethyloct-2-en-1-imine has a molecular weight of 181.32 g/mol, XLogP of 3.99, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-ethyl-N,2-dimethyloct-2-en-1-imine is sourced from PubChem (CID 134424328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).