About 6-fluoro-2-methyl-1-azacyclohepta-2,3,5,7-tetraene
6-fluoro-2-methyl-1-azacyclohepta-2,3,5,7-tetraene (PubChem CID 134424608) has the molecular formula C7H6FN
and a molecular weight of 123.13 g/mol. Its IUPAC name is 6-fluoro-2-methyl-1-azacyclohepta-2,3,5,7-tetraene.
Analyze 6-fluoro-2-methyl-1-azacyclohepta-2,3,5,7-tetraene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-2-methyl-1-azacyclohepta-2,3,5,7-tetraene?
The IUPAC name of 6-fluoro-2-methyl-1-azacyclohepta-2,3,5,7-tetraene (CID 134424608) is 6-fluoro-2-methyl-1-azacyclohepta-2,3,5,7-tetraene.
What is the SMILES notation for 6-fluoro-2-methyl-1-azacyclohepta-2,3,5,7-tetraene?
The canonical SMILES for 6-fluoro-2-methyl-1-azacyclohepta-2,3,5,7-tetraene is CC1=C=CC=C(F)C=N1.
What is the InChIKey of 6-fluoro-2-methyl-1-azacyclohepta-2,3,5,7-tetraene?
The InChIKey is UIDUYMRMPZBGKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6FN/c1-6-3-2-4-7(8)5-9-6/h2,4-5H,1H3.
What are the key properties of 6-fluoro-2-methyl-1-azacyclohepta-2,3,5,7-tetraene?
6-fluoro-2-methyl-1-azacyclohepta-2,3,5,7-tetraene has a molecular weight of 123.13 g/mol, XLogP of 1.98, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-2-methyl-1-azacyclohepta-2,3,5,7-tetraene is sourced from PubChem (CID 134424608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).