About (3E,5E)-6-fluoro-N-hept-1-en-2-ylhepta-3,5-dien-3-amine
(3E,5E)-6-fluoro-N-hept-1-en-2-ylhepta-3,5-dien-3-amine (PubChem CID 134424624) has the molecular formula C14H24FN
and a molecular weight of 225.35 g/mol. Its IUPAC name is (3E,5E)-6-fluoro-N-hept-1-en-2-ylhepta-3,5-dien-3-amine.
Molecular Properties
| Compound Name | (3E,5E)-6-fluoro-N-hept-1-en-2-ylhepta-3,5-dien-3-amine |
| PubChem CID | 134424624 |
| Molecular Formula | C14H24FN |
| Molecular Weight | 225.35 g/mol |
| Exact Mass | 225.19 |
| IUPAC Name | (3E,5E)-6-fluoro-N-hept-1-en-2-ylhepta-3,5-dien-3-amine |
| SMILES | C=C(CCCCC)N/C(=C/C=C(\C)F)CC |
| InChI | InChI=1S/C14H24FN/c1-5-7-8-9-13(4)16-14(6-2)11-10-12(3)15/h10-11,16H,4-9H2,1-3H3/b12-10+,14-11+ |
| InChIKey | BFKTZRWCCWBVJM-NCPBJGSTSA-N |
| XLogP | 4.84 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.35 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E,5E)-6-fluoro-N-hept-1-en-2-ylhepta-3,5-dien-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E,5E)-6-fluoro-N-hept-1-en-2-ylhepta-3,5-dien-3-amine?
The IUPAC name of (3E,5E)-6-fluoro-N-hept-1-en-2-ylhepta-3,5-dien-3-amine (CID 134424624) is (3E,5E)-6-fluoro-N-hept-1-en-2-ylhepta-3,5-dien-3-amine.
What is the SMILES notation for (3E,5E)-6-fluoro-N-hept-1-en-2-ylhepta-3,5-dien-3-amine?
The canonical SMILES for (3E,5E)-6-fluoro-N-hept-1-en-2-ylhepta-3,5-dien-3-amine is C=C(CCCCC)N/C(=C/C=C(\C)F)CC.
What is the InChIKey of (3E,5E)-6-fluoro-N-hept-1-en-2-ylhepta-3,5-dien-3-amine?
The InChIKey is BFKTZRWCCWBVJM-NCPBJGSTSA-N. The full InChI is InChI=1S/C14H24FN/c1-5-7-8-9-13(4)16-14(6-2)11-10-12(3)15/h10-11,16H,4-9H2,1-3H3/b12-10+,14-11+.
What are the key properties of (3E,5E)-6-fluoro-N-hept-1-en-2-ylhepta-3,5-dien-3-amine?
(3E,5E)-6-fluoro-N-hept-1-en-2-ylhepta-3,5-dien-3-amine has a molecular weight of 225.35 g/mol, XLogP of 4.84, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3E,5E)-6-fluoro-N-hept-1-en-2-ylhepta-3,5-dien-3-amine is sourced from PubChem (CID 134424624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).