C24H34N2 — CID 134424832
1-N-ethenyl-3-N-methyl-2,5-dimethylidene-4-[(2Z)-penta-2,4-dien-2-yl]-3-N-pentyl-6-[(Z)-prop-1-enyl]cyclohexa-3,6-diene-1,3-diamine (PubChem CID 134424832) has the molecular formula C24H34N2 and a molecular weight of 350.55 g/mol. Its IUPAC name is 1-N-ethenyl-3-N-methyl-2,5-dimethylidene-4-[(2Z)-penta-2,4-dien-2-yl]-3-N-pentyl-6-[(Z)-prop-1-enyl]cyclohexa-3,6-diene-1,3-diamine.
| Compound Name | 1-N-ethenyl-3-N-methyl-2,5-dimethylidene-4-[(2Z)-penta-2,4-dien-2-yl]-3-N-pentyl-6-[(Z)-prop-1-enyl]cyclohexa-3,6-diene-1,3-diamine |
|---|---|
| PubChem CID | 134424832 |
| Molecular Formula | C24H34N2 |
| Molecular Weight | 350.55 g/mol |
| Exact Mass | 350.27 |
| IUPAC Name | 1-N-ethenyl-3-N-methyl-2,5-dimethylidene-4-[(2Z)-penta-2,4-dien-2-yl]-3-N-pentyl-6-[(Z)-prop-1-enyl]cyclohexa-3,6-diene-1,3-diamine |
| SMILES | C=C/C=C(/C)c1c(N(C)CCCCC)c(=C)c(NC=C)c(/C=C\C)c1=C |
| InChI | InChI=1S/C24H34N2/c1-9-13-14-17-26(8)24-20(7)23(25-12-4)21(16-11-3)19(6)22(24)18(5)15-10-2/h10-12,15-16,25H,2,4,6-7,9,13-14,17H2,1,3,5,8H3/b16-11-,18-15- |
| InChIKey | FGLAFJFCJQNBMH-VCIUWRPASA-N |
| XLogP | 5.31 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.55 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|