About N-amino-N-[(3E,4Z)-3-ethylidenehexa-1,4-dien-2-yl]thiohydroxylamine
N-amino-N-[(3E,4Z)-3-ethylidenehexa-1,4-dien-2-yl]thiohydroxylamine (PubChem CID 134424836) has the molecular formula C8H14N2S
and a molecular weight of 170.28 g/mol. Its IUPAC name is N-amino-N-[(3E,4Z)-3-ethylidenehexa-1,4-dien-2-yl]thiohydroxylamine.
Molecular Properties
| Compound Name | N-amino-N-[(3E,4Z)-3-ethylidenehexa-1,4-dien-2-yl]thiohydroxylamine |
| PubChem CID | 134424836 |
| Molecular Formula | C8H14N2S |
| Molecular Weight | 170.28 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | N-amino-N-[(3E,4Z)-3-ethylidenehexa-1,4-dien-2-yl]thiohydroxylamine |
| SMILES | C=C(C(/C=C\C)=C/C)N(N)S |
| InChI | InChI=1S/C8H14N2S/c1-4-6-8(5-2)7(3)10(9)11/h4-6,11H,3,9H2,1-2H3/b6-4-,8-5+ |
| InChIKey | VQRKWYIMFZRTBV-QXMOYCCXSA-N |
| XLogP | 2.04 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.28 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze N-amino-N-[(3E,4Z)-3-ethylidenehexa-1,4-dien-2-yl]thiohydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-amino-N-[(3E,4Z)-3-ethylidenehexa-1,4-dien-2-yl]thiohydroxylamine?
The IUPAC name of N-amino-N-[(3E,4Z)-3-ethylidenehexa-1,4-dien-2-yl]thiohydroxylamine (CID 134424836) is N-amino-N-[(3E,4Z)-3-ethylidenehexa-1,4-dien-2-yl]thiohydroxylamine.
What is the SMILES notation for N-amino-N-[(3E,4Z)-3-ethylidenehexa-1,4-dien-2-yl]thiohydroxylamine?
The canonical SMILES for N-amino-N-[(3E,4Z)-3-ethylidenehexa-1,4-dien-2-yl]thiohydroxylamine is C=C(C(/C=C\C)=C/C)N(N)S.
What is the InChIKey of N-amino-N-[(3E,4Z)-3-ethylidenehexa-1,4-dien-2-yl]thiohydroxylamine?
The InChIKey is VQRKWYIMFZRTBV-QXMOYCCXSA-N. The full InChI is InChI=1S/C8H14N2S/c1-4-6-8(5-2)7(3)10(9)11/h4-6,11H,3,9H2,1-2H3/b6-4-,8-5+.
What are the key properties of N-amino-N-[(3E,4Z)-3-ethylidenehexa-1,4-dien-2-yl]thiohydroxylamine?
N-amino-N-[(3E,4Z)-3-ethylidenehexa-1,4-dien-2-yl]thiohydroxylamine has a molecular weight of 170.28 g/mol, XLogP of 2.04, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-amino-N-[(3E,4Z)-3-ethylidenehexa-1,4-dien-2-yl]thiohydroxylamine is sourced from PubChem (CID 134424836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).