About [5-(2-amino-6-ethoxy-7,8-dihydropurin-9-yl)-4-methyloxolan-2-yl]methanol
[5-(2-amino-6-ethoxy-7,8-dihydropurin-9-yl)-4-methyloxolan-2-yl]methanol (PubChem CID 134425237) has the molecular formula C13H21N5O3
and a molecular weight of 295.34 g/mol. Its IUPAC name is [5-(2-amino-6-ethoxy-7,8-dihydropurin-9-yl)-4-methyloxolan-2-yl]methanol.
Molecular Properties
| Compound Name | [5-(2-amino-6-ethoxy-7,8-dihydropurin-9-yl)-4-methyloxolan-2-yl]methanol |
| PubChem CID | 134425237 |
| Molecular Formula | C13H21N5O3 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | [5-(2-amino-6-ethoxy-7,8-dihydropurin-9-yl)-4-methyloxolan-2-yl]methanol |
| SMILES | CCOc1nc(N)nc2c1NCN2C1OC(CO)CC1C |
| InChI | InChI=1S/C13H21N5O3/c1-3-20-11-9-10(16-13(14)17-11)18(6-15-9)12-7(2)4-8(5-19)21-12/h7-8,12,15,19H,3-6H2,1-2H3,(H2,14,16,17) |
| InChIKey | HYDMIILSFKFCJB-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze [5-(2-amino-6-ethoxy-7,8-dihydropurin-9-yl)-4-methyloxolan-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(2-amino-6-ethoxy-7,8-dihydropurin-9-yl)-4-methyloxolan-2-yl]methanol?
The IUPAC name of [5-(2-amino-6-ethoxy-7,8-dihydropurin-9-yl)-4-methyloxolan-2-yl]methanol (CID 134425237) is [5-(2-amino-6-ethoxy-7,8-dihydropurin-9-yl)-4-methyloxolan-2-yl]methanol.
What is the SMILES notation for [5-(2-amino-6-ethoxy-7,8-dihydropurin-9-yl)-4-methyloxolan-2-yl]methanol?
The canonical SMILES for [5-(2-amino-6-ethoxy-7,8-dihydropurin-9-yl)-4-methyloxolan-2-yl]methanol is CCOc1nc(N)nc2c1NCN2C1OC(CO)CC1C.
What is the InChIKey of [5-(2-amino-6-ethoxy-7,8-dihydropurin-9-yl)-4-methyloxolan-2-yl]methanol?
The InChIKey is HYDMIILSFKFCJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N5O3/c1-3-20-11-9-10(16-13(14)17-11)18(6-15-9)12-7(2)4-8(5-19)21-12/h7-8,12,15,19H,3-6H2,1-2H3,(H2,14,16,17).
What are the key properties of [5-(2-amino-6-ethoxy-7,8-dihydropurin-9-yl)-4-methyloxolan-2-yl]methanol?
[5-(2-amino-6-ethoxy-7,8-dihydropurin-9-yl)-4-methyloxolan-2-yl]methanol has a molecular weight of 295.34 g/mol, XLogP of 0.39, 4 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(2-amino-6-ethoxy-7,8-dihydropurin-9-yl)-4-methyloxolan-2-yl]methanol is sourced from PubChem (CID 134425237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).