About 4-ethenyl-1,3-dimethyl-5-[(Z)-prop-1-enyl]-2,3-dihydropyrrole
4-ethenyl-1,3-dimethyl-5-[(Z)-prop-1-enyl]-2,3-dihydropyrrole (PubChem CID 134425367) has the molecular formula C11H17N
and a molecular weight of 163.26 g/mol. Its IUPAC name is 4-ethenyl-1,3-dimethyl-5-[(Z)-prop-1-enyl]-2,3-dihydropyrrole.
Molecular Properties
| Compound Name | 4-ethenyl-1,3-dimethyl-5-[(Z)-prop-1-enyl]-2,3-dihydropyrrole |
| PubChem CID | 134425367 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | 4-ethenyl-1,3-dimethyl-5-[(Z)-prop-1-enyl]-2,3-dihydropyrrole |
| SMILES | C=CC1=C(/C=C\C)N(C)CC1C |
| InChI | InChI=1S/C11H17N/c1-5-7-11-10(6-2)9(3)8-12(11)4/h5-7,9H,2,8H2,1,3-4H3/b7-5- |
| InChIKey | GIYZETRGEKEKRS-ALCCZGGFSA-N |
| XLogP | 2.58 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-ethenyl-1,3-dimethyl-5-[(Z)-prop-1-enyl]-2,3-dihydropyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethenyl-1,3-dimethyl-5-[(Z)-prop-1-enyl]-2,3-dihydropyrrole?
The IUPAC name of 4-ethenyl-1,3-dimethyl-5-[(Z)-prop-1-enyl]-2,3-dihydropyrrole (CID 134425367) is 4-ethenyl-1,3-dimethyl-5-[(Z)-prop-1-enyl]-2,3-dihydropyrrole.
What is the SMILES notation for 4-ethenyl-1,3-dimethyl-5-[(Z)-prop-1-enyl]-2,3-dihydropyrrole?
The canonical SMILES for 4-ethenyl-1,3-dimethyl-5-[(Z)-prop-1-enyl]-2,3-dihydropyrrole is C=CC1=C(/C=C\C)N(C)CC1C.
What is the InChIKey of 4-ethenyl-1,3-dimethyl-5-[(Z)-prop-1-enyl]-2,3-dihydropyrrole?
The InChIKey is GIYZETRGEKEKRS-ALCCZGGFSA-N. The full InChI is InChI=1S/C11H17N/c1-5-7-11-10(6-2)9(3)8-12(11)4/h5-7,9H,2,8H2,1,3-4H3/b7-5-.
What are the key properties of 4-ethenyl-1,3-dimethyl-5-[(Z)-prop-1-enyl]-2,3-dihydropyrrole?
4-ethenyl-1,3-dimethyl-5-[(Z)-prop-1-enyl]-2,3-dihydropyrrole has a molecular weight of 163.26 g/mol, XLogP of 2.58, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethenyl-1,3-dimethyl-5-[(Z)-prop-1-enyl]-2,3-dihydropyrrole is sourced from PubChem (CID 134425367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).