About 5-(3,4-diethylphenyl)-3-(trifluoromethyl)-2,4-dihydropyrrol-3-ol
5-(3,4-diethylphenyl)-3-(trifluoromethyl)-2,4-dihydropyrrol-3-ol (PubChem CID 134425514) has the molecular formula C15H18F3NO
and a molecular weight of 285.31 g/mol. Its IUPAC name is 5-(3,4-diethylphenyl)-3-(trifluoromethyl)-2,4-dihydropyrrol-3-ol.
Molecular Properties
| Compound Name | 5-(3,4-diethylphenyl)-3-(trifluoromethyl)-2,4-dihydropyrrol-3-ol |
| PubChem CID | 134425514 |
| Molecular Formula | C15H18F3NO |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 5-(3,4-diethylphenyl)-3-(trifluoromethyl)-2,4-dihydropyrrol-3-ol |
| SMILES | CCc1ccc(C2=NCC(O)(C(F)(F)F)C2)cc1CC |
| InChI | InChI=1S/C15H18F3NO/c1-3-10-5-6-12(7-11(10)4-2)13-8-14(20,9-19-13)15(16,17)18/h5-7,20H,3-4,8-9H2,1-2H3 |
| InChIKey | FQIGGFJBJTYXKN-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(3,4-diethylphenyl)-3-(trifluoromethyl)-2,4-dihydropyrrol-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,4-diethylphenyl)-3-(trifluoromethyl)-2,4-dihydropyrrol-3-ol?
The IUPAC name of 5-(3,4-diethylphenyl)-3-(trifluoromethyl)-2,4-dihydropyrrol-3-ol (CID 134425514) is 5-(3,4-diethylphenyl)-3-(trifluoromethyl)-2,4-dihydropyrrol-3-ol.
What is the SMILES notation for 5-(3,4-diethylphenyl)-3-(trifluoromethyl)-2,4-dihydropyrrol-3-ol?
The canonical SMILES for 5-(3,4-diethylphenyl)-3-(trifluoromethyl)-2,4-dihydropyrrol-3-ol is CCc1ccc(C2=NCC(O)(C(F)(F)F)C2)cc1CC.
What is the InChIKey of 5-(3,4-diethylphenyl)-3-(trifluoromethyl)-2,4-dihydropyrrol-3-ol?
The InChIKey is FQIGGFJBJTYXKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18F3NO/c1-3-10-5-6-12(7-11(10)4-2)13-8-14(20,9-19-13)15(16,17)18/h5-7,20H,3-4,8-9H2,1-2H3.
What are the key properties of 5-(3,4-diethylphenyl)-3-(trifluoromethyl)-2,4-dihydropyrrol-3-ol?
5-(3,4-diethylphenyl)-3-(trifluoromethyl)-2,4-dihydropyrrol-3-ol has a molecular weight of 285.31 g/mol, XLogP of 3.30, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,4-diethylphenyl)-3-(trifluoromethyl)-2,4-dihydropyrrol-3-ol is sourced from PubChem (CID 134425514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).