C13H23N — CID 134426211
(3Z)-3-ethylidene-5,5,6-trimethyl-2-propyl-2,4-dihydropyridine (PubChem CID 134426211) has the molecular formula C13H23N and a molecular weight of 193.33 g/mol. Its IUPAC name is (3Z)-3-ethylidene-5,5,6-trimethyl-2-propyl-2,4-dihydropyridine.
| Compound Name | (3Z)-3-ethylidene-5,5,6-trimethyl-2-propyl-2,4-dihydropyridine |
|---|---|
| PubChem CID | 134426211 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | (3Z)-3-ethylidene-5,5,6-trimethyl-2-propyl-2,4-dihydropyridine |
| SMILES | C/C=C1/CC(C)(C)C(C)=NC1CCC |
| InChI | InChI=1S/C13H23N/c1-6-8-12-11(7-2)9-13(4,5)10(3)14-12/h7,12H,6,8-9H2,1-5H3/b11-7- |
| InChIKey | IWJAKHGJESRHFX-XFFZJAGNSA-N |
| XLogP | 3.99 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|