C18H23N3 — CID 134426367
(8E)-8-(1-cyclohexa-1,3-dien-1-ylethylidene)-2-ethyl-1,2,5,6-tetrahydroquinazolin-7-imine (PubChem CID 134426367) has the molecular formula C18H23N3 and a molecular weight of 281.40 g/mol. Its IUPAC name is (8E)-8-(1-cyclohexa-1,3-dien-1-ylethylidene)-2-ethyl-1,2,5,6-tetrahydroquinazolin-7-imine.
| Compound Name | (8E)-8-(1-cyclohexa-1,3-dien-1-ylethylidene)-2-ethyl-1,2,5,6-tetrahydroquinazolin-7-imine |
|---|---|
| PubChem CID | 134426367 |
| Molecular Formula | C18H23N3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | (8E)-8-(1-cyclohexa-1,3-dien-1-ylethylidene)-2-ethyl-1,2,5,6-tetrahydroquinazolin-7-imine |
| SMILES | [H]/N=C1\CCC2=C(NC(CC)N=C2)\C1=C(\C)C1=CC=CCC1 |
| InChI | InChI=1S/C18H23N3/c1-3-16-20-11-14-9-10-15(19)17(18(14)21-16)12(2)13-7-5-4-6-8-13/h4-5,7,11,16,19,21H,3,6,8-10H2,1-2H3/b17-12-,19-15+ |
| InChIKey | MGEABPICSSULEV-KTOVDBTRSA-N |
| XLogP | 4.06 |
| TPSA | 48.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|