About nonylurea
nonylurea (PubChem CID 13442645) has the molecular formula C10H22N2O
and a molecular weight of 186.30 g/mol. Its IUPAC name is nonylurea.
Molecular Properties
| Compound Name | nonylurea |
| PubChem CID | 13442645 |
| Molecular Formula | C10H22N2O |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.17 |
| IUPAC Name | nonylurea |
| SMILES | CCCCCCCCCNC(N)=O |
| InChI | InChI=1S/C10H22N2O/c1-2-3-4-5-6-7-8-9-12-10(11)13/h2-9H2,1H3,(H3,11,12,13) |
| InChIKey | UWOOQFOHVDZTOD-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze nonylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nonylurea?
The IUPAC name of nonylurea (CID 13442645) is nonylurea.
What is the SMILES notation for nonylurea?
The canonical SMILES for nonylurea is CCCCCCCCCNC(N)=O.
What is the InChIKey of nonylurea?
The InChIKey is UWOOQFOHVDZTOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N2O/c1-2-3-4-5-6-7-8-9-12-10(11)13/h2-9H2,1H3,(H3,11,12,13).
What are the key properties of nonylurea?
nonylurea has a molecular weight of 186.30 g/mol, XLogP of 2.41, 8 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for nonylurea is sourced from PubChem (CID 13442645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).