C23H24F3N5O — CID 134426968
[2-imino-3-(6-methylpyridine-2-carboximidoyl)-3,9-diazabicyclo[3.3.1]nonan-9-yl]-[2-methyl-3-(trifluoromethyl)phenyl]methanone (PubChem CID 134426968) has the molecular formula C23H24F3N5O and a molecular weight of 443.47 g/mol. Its IUPAC name is [2-imino-3-(6-methylpyridine-2-carboximidoyl)-3,9-diazabicyclo[3.3.1]nonan-9-yl]-[2-methyl-3-(trifluoromethyl)phenyl]methanone.
| Compound Name | [2-imino-3-(6-methylpyridine-2-carboximidoyl)-3,9-diazabicyclo[3.3.1]nonan-9-yl]-[2-methyl-3-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 134426968 |
| Molecular Formula | C23H24F3N5O |
| Molecular Weight | 443.47 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | [2-imino-3-(6-methylpyridine-2-carboximidoyl)-3,9-diazabicyclo[3.3.1]nonan-9-yl]-[2-methyl-3-(trifluoromethyl)phenyl]methanone |
| SMILES | [H]/N=C(\c1cccc(C)n1)N1CC2CCCC(/C1=N\[H])N2C(=O)c1cccc(C(F)(F)F)c1C |
| InChI | InChI=1S/C23H24F3N5O/c1-13-6-3-10-18(29-13)20(27)30-12-15-7-4-11-19(21(30)28)31(15)22(32)16-8-5-9-17(14(16)2)23(24,25)26/h3,5-6,8-10,15,19,27-28H,4,7,11-12H2,1-2H3/b27-20+,28-21+ |
| InChIKey | KJRPDINLOYXFFM-KUKFKUQFSA-N |
| XLogP | 4.40 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.47 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|