C29H36ClF3N2O3 — CID 134427191
2-chloro-4-[4-[1-[(2S)-2-(3-ethylphenyl)-3,3,3-trifluoropropanoyl]piperidin-4-yl]butoxy]-N,N-dimethylbenzamide (PubChem CID 134427191) has the molecular formula C29H36ClF3N2O3 and a molecular weight of 553.07 g/mol. Its IUPAC name is 2-chloro-4-[4-[1-[(2S)-2-(3-ethylphenyl)-3,3,3-trifluoropropanoyl]piperidin-4-yl]butoxy]-N,N-dimethylbenzamide.
| Compound Name | 2-chloro-4-[4-[1-[(2S)-2-(3-ethylphenyl)-3,3,3-trifluoropropanoyl]piperidin-4-yl]butoxy]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 134427191 |
| Molecular Formula | C29H36ClF3N2O3 |
| Molecular Weight | 553.07 g/mol |
| Exact Mass | 552.24 |
| IUPAC Name | 2-chloro-4-[4-[1-[(2S)-2-(3-ethylphenyl)-3,3,3-trifluoropropanoyl]piperidin-4-yl]butoxy]-N,N-dimethylbenzamide |
| SMILES | CCc1cccc([C@@H](C(=O)N2CCC(CCCCOc3ccc(C(=O)N(C)C)c(Cl)c3)CC2)C(F)(F)F)c1 |
| InChI | InChI=1S/C29H36ClF3N2O3/c1-4-20-9-7-10-22(18-20)26(29(31,32)33)28(37)35-15-13-21(14-16-35)8-5-6-17-38-23-11-12-24(25(30)19-23)27(36)34(2)3/h7,9-12,18-19,21,26H,4-6,8,13-17H2,1-3H3/t26-/m0/s1 |
| InChIKey | GDDSAOFYGXKEPQ-SANMLTNESA-N |
| XLogP | 6.74 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.07 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|