C28H34ClF3N2O4 — CID 134427193
2-chloro-N,N-dimethyl-4-[4-[1-[3,3,3-trifluoro-2-(3-methoxyphenyl)propanoyl]piperidin-4-yl]butoxy]benzamide (PubChem CID 134427193) has the molecular formula C28H34ClF3N2O4 and a molecular weight of 555.04 g/mol. Its IUPAC name is 2-chloro-N,N-dimethyl-4-[4-[1-[3,3,3-trifluoro-2-(3-methoxyphenyl)propanoyl]piperidin-4-yl]butoxy]benzamide.
| Compound Name | 2-chloro-N,N-dimethyl-4-[4-[1-[3,3,3-trifluoro-2-(3-methoxyphenyl)propanoyl]piperidin-4-yl]butoxy]benzamide |
|---|---|
| PubChem CID | 134427193 |
| Molecular Formula | C28H34ClF3N2O4 |
| Molecular Weight | 555.04 g/mol |
| Exact Mass | 554.22 |
| IUPAC Name | 2-chloro-N,N-dimethyl-4-[4-[1-[3,3,3-trifluoro-2-(3-methoxyphenyl)propanoyl]piperidin-4-yl]butoxy]benzamide |
| SMILES | COc1cccc(C(C(=O)N2CCC(CCCCOc3ccc(C(=O)N(C)C)c(Cl)c3)CC2)C(F)(F)F)c1 |
| InChI | InChI=1S/C28H34ClF3N2O4/c1-33(2)26(35)23-11-10-22(18-24(23)29)38-16-5-4-7-19-12-14-34(15-13-19)27(36)25(28(30,31)32)20-8-6-9-21(17-20)37-3/h6,8-11,17-19,25H,4-5,7,12-16H2,1-3H3 |
| InChIKey | RZHAYAJWUTUFGM-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.04 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|