C29H34ClF3N2O4 — CID 134427210
2-chloro-N-methyl-N-(oxetan-3-yl)-4-[4-[1-[(2S)-3,3,3-trifluoro-2-phenylpropanoyl]piperidin-4-yl]butoxy]benzamide (PubChem CID 134427210) has the molecular formula C29H34ClF3N2O4 and a molecular weight of 567.05 g/mol. Its IUPAC name is 2-chloro-N-methyl-N-(oxetan-3-yl)-4-[4-[1-[(2S)-3,3,3-trifluoro-2-phenylpropanoyl]piperidin-4-yl]butoxy]benzamide.
| Compound Name | 2-chloro-N-methyl-N-(oxetan-3-yl)-4-[4-[1-[(2S)-3,3,3-trifluoro-2-phenylpropanoyl]piperidin-4-yl]butoxy]benzamide |
|---|---|
| PubChem CID | 134427210 |
| Molecular Formula | C29H34ClF3N2O4 |
| Molecular Weight | 567.05 g/mol |
| Exact Mass | 566.22 |
| IUPAC Name | 2-chloro-N-methyl-N-(oxetan-3-yl)-4-[4-[1-[(2S)-3,3,3-trifluoro-2-phenylpropanoyl]piperidin-4-yl]butoxy]benzamide |
| SMILES | CN(C(=O)c1ccc(OCCCCC2CCN(C(=O)[C@H](c3ccccc3)C(F)(F)F)CC2)cc1Cl)C1COC1 |
| InChI | InChI=1S/C29H34ClF3N2O4/c1-34(22-18-38-19-22)27(36)24-11-10-23(17-25(24)30)39-16-6-5-7-20-12-14-35(15-13-20)28(37)26(29(31,32)33)21-8-3-2-4-9-21/h2-4,8-11,17,20,22,26H,5-7,12-16,18-19H2,1H3/t26-/m0/s1 |
| InChIKey | NTYFWRYEHPDEJZ-SANMLTNESA-N |
| XLogP | 5.94 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.05 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|