C13H16O4 — CID 13442731
(7-oxocyclohepta-1,3,5-trien-1-yl)oxymethyl 2,2-dimethylpropanoate (PubChem CID 13442731) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is (7-oxocyclohepta-1,3,5-trien-1-yl)oxymethyl 2,2-dimethylpropanoate.
| Compound Name | (7-oxocyclohepta-1,3,5-trien-1-yl)oxymethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 13442731 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | (7-oxocyclohepta-1,3,5-trien-1-yl)oxymethyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCOc1cccccc1=O |
| InChI | InChI=1S/C13H16O4/c1-13(2,3)12(15)17-9-16-11-8-6-4-5-7-10(11)14/h4-8H,9H2,1-3H3 |
| InChIKey | HYSLBDRENXFLGZ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|