C20H34O4 — CID 134427490
[(E,2R)-2-[(4R,6S)-2-ethenyl-6-ethyl-5,5-dimethyl-1,3-dioxan-4-yl]-3,4-dimethylhex-3-en-2-yl] acetate (PubChem CID 134427490) has the molecular formula C20H34O4 and a molecular weight of 338.49 g/mol. Its IUPAC name is [(E,2R)-2-[(4R,6S)-2-ethenyl-6-ethyl-5,5-dimethyl-1,3-dioxan-4-yl]-3,4-dimethylhex-3-en-2-yl] acetate.
| Compound Name | [(E,2R)-2-[(4R,6S)-2-ethenyl-6-ethyl-5,5-dimethyl-1,3-dioxan-4-yl]-3,4-dimethylhex-3-en-2-yl] acetate |
|---|---|
| PubChem CID | 134427490 |
| Molecular Formula | C20H34O4 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.25 |
| IUPAC Name | [(E,2R)-2-[(4R,6S)-2-ethenyl-6-ethyl-5,5-dimethyl-1,3-dioxan-4-yl]-3,4-dimethylhex-3-en-2-yl] acetate |
| SMILES | C=CC1O[C@@H](CC)C(C)(C)[C@H]([C@](C)(OC(C)=O)/C(C)=C(\C)CC)O1 |
| InChI | InChI=1S/C20H34O4/c1-10-13(4)14(5)20(9,24-15(6)21)18-19(7,8)16(11-2)22-17(12-3)23-18/h12,16-18H,3,10-11H2,1-2,4-9H3/b14-13+/t16-,17?,18+,20+/m0/s1 |
| InChIKey | KBXPHFFEVKDTML-YUWPLBSESA-N |
| XLogP | 4.79 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|