About heptan-2-yl 2-[2-[3-(4-morpholin-4-ylpiperidin-1-yl)-3-oxopropyl]imidazol-1-yl]acetate
heptan-2-yl 2-[2-[3-(4-morpholin-4-ylpiperidin-1-yl)-3-oxopropyl]imidazol-1-yl]acetate (PubChem CID 134427995) has the molecular formula C24H40N4O4
and a molecular weight of 448.61 g/mol. Its IUPAC name is heptan-2-yl 2-[2-[3-(4-morpholin-4-ylpiperidin-1-yl)-3-oxopropyl]imidazol-1-yl]acetate.
Molecular Properties
| Compound Name | heptan-2-yl 2-[2-[3-(4-morpholin-4-ylpiperidin-1-yl)-3-oxopropyl]imidazol-1-yl]acetate |
| PubChem CID | 134427995 |
| Molecular Formula | C24H40N4O4 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.30 |
| IUPAC Name | heptan-2-yl 2-[2-[3-(4-morpholin-4-ylpiperidin-1-yl)-3-oxopropyl]imidazol-1-yl]acetate |
| SMILES | CCCCCC(C)OC(=O)Cn1ccnc1CCC(=O)N1CCC(N2CCOCC2)CC1 |
| InChI | InChI=1S/C24H40N4O4/c1-3-4-5-6-20(2)32-24(30)19-28-14-11-25-22(28)7-8-23(29)27-12-9-21(10-13-27)26-15-17-31-18-16-26/h11,14,20-21H,3-10,12-13,15-19H2,1-2H3 |
| InChIKey | UARWZDSRVUMJAU-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 76.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze heptan-2-yl 2-[2-[3-(4-morpholin-4-ylpiperidin-1-yl)-3-oxopropyl]imidazol-1-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptan-2-yl 2-[2-[3-(4-morpholin-4-ylpiperidin-1-yl)-3-oxopropyl]imidazol-1-yl]acetate?
The IUPAC name of heptan-2-yl 2-[2-[3-(4-morpholin-4-ylpiperidin-1-yl)-3-oxopropyl]imidazol-1-yl]acetate (CID 134427995) is heptan-2-yl 2-[2-[3-(4-morpholin-4-ylpiperidin-1-yl)-3-oxopropyl]imidazol-1-yl]acetate.
What is the SMILES notation for heptan-2-yl 2-[2-[3-(4-morpholin-4-ylpiperidin-1-yl)-3-oxopropyl]imidazol-1-yl]acetate?
The canonical SMILES for heptan-2-yl 2-[2-[3-(4-morpholin-4-ylpiperidin-1-yl)-3-oxopropyl]imidazol-1-yl]acetate is CCCCCC(C)OC(=O)Cn1ccnc1CCC(=O)N1CCC(N2CCOCC2)CC1.
What is the InChIKey of heptan-2-yl 2-[2-[3-(4-morpholin-4-ylpiperidin-1-yl)-3-oxopropyl]imidazol-1-yl]acetate?
The InChIKey is UARWZDSRVUMJAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H40N4O4/c1-3-4-5-6-20(2)32-24(30)19-28-14-11-25-22(28)7-8-23(29)27-12-9-21(10-13-27)26-15-17-31-18-16-26/h11,14,20-21H,3-10,12-13,15-19H2,1-2H3.
What are the key properties of heptan-2-yl 2-[2-[3-(4-morpholin-4-ylpiperidin-1-yl)-3-oxopropyl]imidazol-1-yl]acetate?
heptan-2-yl 2-[2-[3-(4-morpholin-4-ylpiperidin-1-yl)-3-oxopropyl]imidazol-1-yl]acetate has a molecular weight of 448.61 g/mol, XLogP of 2.65, 11 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for heptan-2-yl 2-[2-[3-(4-morpholin-4-ylpiperidin-1-yl)-3-oxopropyl]imidazol-1-yl]acetate is sourced from PubChem (CID 134427995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).