C21H25F3N4OS — CID 134429275
N-(4,6-dimethyl-2-pyridinyl)-3-(hydroxymethyl)-4-[[4-(trifluoromethyl)phenyl]methyl]piperazine-1-carbothioamide (PubChem CID 134429275) has the molecular formula C21H25F3N4OS and a molecular weight of 438.52 g/mol. Its IUPAC name is N-(4,6-dimethyl-2-pyridinyl)-3-(hydroxymethyl)-4-[[4-(trifluoromethyl)phenyl]methyl]piperazine-1-carbothioamide.
| Compound Name | N-(4,6-dimethyl-2-pyridinyl)-3-(hydroxymethyl)-4-[[4-(trifluoromethyl)phenyl]methyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 134429275 |
| Molecular Formula | C21H25F3N4OS |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | N-(4,6-dimethyl-2-pyridinyl)-3-(hydroxymethyl)-4-[[4-(trifluoromethyl)phenyl]methyl]piperazine-1-carbothioamide |
| SMILES | Cc1cc(C)nc(NC(=S)N2CCN(Cc3ccc(C(F)(F)F)cc3)C(CO)C2)c1 |
| InChI | InChI=1S/C21H25F3N4OS/c1-14-9-15(2)25-19(10-14)26-20(30)28-8-7-27(18(12-28)13-29)11-16-3-5-17(6-4-16)21(22,23)24/h3-6,9-10,18,29H,7-8,11-13H2,1-2H3,(H,25,26,30) |
| InChIKey | CIRINRRRKRRGOS-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 51.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|