C15H32N2O4 — CID 134429316
1-[2-[2-hydroxy-3-(4-methylpiperazin-1-yl)propoxy]propoxy]butan-2-ol (PubChem CID 134429316) has the molecular formula C15H32N2O4 and a molecular weight of 304.43 g/mol. Its IUPAC name is 1-[2-[2-hydroxy-3-(4-methylpiperazin-1-yl)propoxy]propoxy]butan-2-ol.
| Compound Name | 1-[2-[2-hydroxy-3-(4-methylpiperazin-1-yl)propoxy]propoxy]butan-2-ol |
|---|---|
| PubChem CID | 134429316 |
| Molecular Formula | C15H32N2O4 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | 1-[2-[2-hydroxy-3-(4-methylpiperazin-1-yl)propoxy]propoxy]butan-2-ol |
| SMILES | CCC(O)COCC(C)OCC(O)CN1CCN(C)CC1 |
| InChI | InChI=1S/C15H32N2O4/c1-4-14(18)11-20-10-13(2)21-12-15(19)9-17-7-5-16(3)6-8-17/h13-15,18-19H,4-12H2,1-3H3 |
| InChIKey | QGPDIAVKVPKBQU-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 65.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |