C13H23F3N2 — CID 134429382
(1S,2S)-1-N-tert-butyl-2-N,2-N-dimethyl-4-(trifluoromethyl)cyclohex-4-ene-1,2-diamine (PubChem CID 134429382) has the molecular formula C13H23F3N2 and a molecular weight of 264.33 g/mol. Its IUPAC name is (1S,2S)-1-N-tert-butyl-2-N,2-N-dimethyl-4-(trifluoromethyl)cyclohex-4-ene-1,2-diamine.
| Compound Name | (1S,2S)-1-N-tert-butyl-2-N,2-N-dimethyl-4-(trifluoromethyl)cyclohex-4-ene-1,2-diamine |
|---|---|
| PubChem CID | 134429382 |
| Molecular Formula | C13H23F3N2 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | (1S,2S)-1-N-tert-butyl-2-N,2-N-dimethyl-4-(trifluoromethyl)cyclohex-4-ene-1,2-diamine |
| SMILES | CN(C)[C@H]1CC(C(F)(F)F)=CC[C@@H]1NC(C)(C)C |
| InChI | InChI=1S/C13H23F3N2/c1-12(2,3)17-10-7-6-9(13(14,15)16)8-11(10)18(4)5/h6,10-11,17H,7-8H2,1-5H3/t10-,11-/m0/s1 |
| InChIKey | XCDBNFRDGFPKIX-QWRGUYRKSA-N |
| XLogP | 2.96 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|