About [(3R)-3-fluoro-1-[(1S,2S)-2-(propan-2-ylamino)cyclohexyl]piperidin-3-yl]methanol
[(3R)-3-fluoro-1-[(1S,2S)-2-(propan-2-ylamino)cyclohexyl]piperidin-3-yl]methanol (PubChem CID 134429520) has the molecular formula C15H29FN2O
and a molecular weight of 272.41 g/mol. Its IUPAC name is [(3R)-3-fluoro-1-[(1S,2S)-2-(propan-2-ylamino)cyclohexyl]piperidin-3-yl]methanol.
Molecular Properties
| Compound Name | [(3R)-3-fluoro-1-[(1S,2S)-2-(propan-2-ylamino)cyclohexyl]piperidin-3-yl]methanol |
| PubChem CID | 134429520 |
| Molecular Formula | C15H29FN2O |
| Molecular Weight | 272.41 g/mol |
| Exact Mass | 272.23 |
| IUPAC Name | [(3R)-3-fluoro-1-[(1S,2S)-2-(propan-2-ylamino)cyclohexyl]piperidin-3-yl]methanol |
| SMILES | CC(C)N[C@H]1CCCC[C@@H]1N1CCC[C@](F)(CO)C1 |
| InChI | InChI=1S/C15H29FN2O/c1-12(2)17-13-6-3-4-7-14(13)18-9-5-8-15(16,10-18)11-19/h12-14,17,19H,3-11H2,1-2H3/t13-,14-,15+/m0/s1 |
| InChIKey | WKECKQDZFAOLBS-SOUVJXGZSA-N |
| XLogP | 2.09 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.41 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(3R)-3-fluoro-1-[(1S,2S)-2-(propan-2-ylamino)cyclohexyl]piperidin-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R)-3-fluoro-1-[(1S,2S)-2-(propan-2-ylamino)cyclohexyl]piperidin-3-yl]methanol?
The IUPAC name of [(3R)-3-fluoro-1-[(1S,2S)-2-(propan-2-ylamino)cyclohexyl]piperidin-3-yl]methanol (CID 134429520) is [(3R)-3-fluoro-1-[(1S,2S)-2-(propan-2-ylamino)cyclohexyl]piperidin-3-yl]methanol.
What is the SMILES notation for [(3R)-3-fluoro-1-[(1S,2S)-2-(propan-2-ylamino)cyclohexyl]piperidin-3-yl]methanol?
The canonical SMILES for [(3R)-3-fluoro-1-[(1S,2S)-2-(propan-2-ylamino)cyclohexyl]piperidin-3-yl]methanol is CC(C)N[C@H]1CCCC[C@@H]1N1CCC[C@](F)(CO)C1.
What is the InChIKey of [(3R)-3-fluoro-1-[(1S,2S)-2-(propan-2-ylamino)cyclohexyl]piperidin-3-yl]methanol?
The InChIKey is WKECKQDZFAOLBS-SOUVJXGZSA-N. The full InChI is InChI=1S/C15H29FN2O/c1-12(2)17-13-6-3-4-7-14(13)18-9-5-8-15(16,10-18)11-19/h12-14,17,19H,3-11H2,1-2H3/t13-,14-,15+/m0/s1.
What are the key properties of [(3R)-3-fluoro-1-[(1S,2S)-2-(propan-2-ylamino)cyclohexyl]piperidin-3-yl]methanol?
[(3R)-3-fluoro-1-[(1S,2S)-2-(propan-2-ylamino)cyclohexyl]piperidin-3-yl]methanol has a molecular weight of 272.41 g/mol, XLogP of 2.09, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R)-3-fluoro-1-[(1S,2S)-2-(propan-2-ylamino)cyclohexyl]piperidin-3-yl]methanol is sourced from PubChem (CID 134429520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).