C21H26ClF2N5O2S — CID 134429582
4-[[(1S,2S)-2-[azetidin-3-yl(methyl)amino]cyclohexyl]amino]-5-chloro-2-fluoro-N-(6-fluoro-2-pyridinyl)benzenesulfonamide (PubChem CID 134429582) has the molecular formula C21H26ClF2N5O2S and a molecular weight of 485.99 g/mol. Its IUPAC name is 4-[[(1S,2S)-2-[azetidin-3-yl(methyl)amino]cyclohexyl]amino]-5-chloro-2-fluoro-N-(6-fluoro-2-pyridinyl)benzenesulfonamide.
| Compound Name | 4-[[(1S,2S)-2-[azetidin-3-yl(methyl)amino]cyclohexyl]amino]-5-chloro-2-fluoro-N-(6-fluoro-2-pyridinyl)benzenesulfonamide |
|---|---|
| PubChem CID | 134429582 |
| Molecular Formula | C21H26ClF2N5O2S |
| Molecular Weight | 485.99 g/mol |
| Exact Mass | 485.15 |
| IUPAC Name | 4-[[(1S,2S)-2-[azetidin-3-yl(methyl)amino]cyclohexyl]amino]-5-chloro-2-fluoro-N-(6-fluoro-2-pyridinyl)benzenesulfonamide |
| SMILES | CN(C1CNC1)[C@H]1CCCC[C@@H]1Nc1cc(F)c(S(=O)(=O)Nc2cccc(F)n2)cc1Cl |
| InChI | InChI=1S/C21H26ClF2N5O2S/c1-29(13-11-25-12-13)18-6-3-2-5-16(18)26-17-10-15(23)19(9-14(17)22)32(30,31)28-21-8-4-7-20(24)27-21/h4,7-10,13,16,18,25-26H,2-3,5-6,11-12H2,1H3,(H,27,28)/t16-,18-/m0/s1 |
| InChIKey | AFZOVJYCEWFXQS-WMZOPIPTSA-N |
| XLogP | 3.44 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.99 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|