C19H23Cl2FN4O2S — CID 134429595
5-chloro-N-(6-chloro-2-pyridinyl)-4-[[(1S,2S)-2-(dimethylamino)cyclohexyl]amino]-2-fluorobenzenesulfonamide (PubChem CID 134429595) has the molecular formula C19H23Cl2FN4O2S and a molecular weight of 461.39 g/mol. Its IUPAC name is 5-chloro-N-(6-chloro-2-pyridinyl)-4-[[(1S,2S)-2-(dimethylamino)cyclohexyl]amino]-2-fluorobenzenesulfonamide.
| Compound Name | 5-chloro-N-(6-chloro-2-pyridinyl)-4-[[(1S,2S)-2-(dimethylamino)cyclohexyl]amino]-2-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 134429595 |
| Molecular Formula | C19H23Cl2FN4O2S |
| Molecular Weight | 461.39 g/mol |
| Exact Mass | 460.09 |
| IUPAC Name | 5-chloro-N-(6-chloro-2-pyridinyl)-4-[[(1S,2S)-2-(dimethylamino)cyclohexyl]amino]-2-fluorobenzenesulfonamide |
| SMILES | CN(C)[C@H]1CCCC[C@@H]1Nc1cc(F)c(S(=O)(=O)Nc2cccc(Cl)n2)cc1Cl |
| InChI | InChI=1S/C19H23Cl2FN4O2S/c1-26(2)16-7-4-3-6-14(16)23-15-11-13(22)17(10-12(15)20)29(27,28)25-19-9-5-8-18(21)24-19/h5,8-11,14,16,23H,3-4,6-7H2,1-2H3,(H,24,25)/t14-,16-/m0/s1 |
| InChIKey | PGUHQAAXKBKAIG-HOCLYGCPSA-N |
| XLogP | 4.61 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.39 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|